C20H23F3N4O4 — CID 88542273
4-[[5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]methoxy]-N'-hydroxypiperidine-1-carboximidamide (PubChem CID 88542273) has the molecular formula C20H23F3N4O4 and a molecular weight of 440.42 g/mol. Its IUPAC name is 4-[[5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]methoxy]-N'-hydroxypiperidine-1-carboximidamide.
| Compound Name | 4-[[5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]methoxy]-N'-hydroxypiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 88542273 |
| Molecular Formula | C20H23F3N4O4 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 4-[[5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]methoxy]-N'-hydroxypiperidine-1-carboximidamide |
| SMILES | N/C(=N\O)N1CCC(OCc2c(-c3ccccc3OC(F)(F)F)noc2C2CC2)CC1 |
| InChI | InChI=1S/C20H23F3N4O4/c21-20(22,23)30-16-4-2-1-3-14(16)17-15(18(31-26-17)12-5-6-12)11-29-13-7-9-27(10-8-13)19(24)25-28/h1-4,12-13,28H,5-11H2,(H2,24,25) |
| InChIKey | NBUKFDHBYPXHTF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|