C26H25F5N4O4 — CID 174228818
4-[4-[[5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]methoxy]-3,3-difluoropiperidin-1-yl]-N'-hydroxybenzenecarboximidamide (PubChem CID 174228818) has the molecular formula C26H25F5N4O4 and a molecular weight of 552.50 g/mol. Its IUPAC name is 4-[4-[[5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]methoxy]-3,3-difluoropiperidin-1-yl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[4-[[5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]methoxy]-3,3-difluoropiperidin-1-yl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 174228818 |
| Molecular Formula | C26H25F5N4O4 |
| Molecular Weight | 552.50 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | 4-[4-[[5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]methoxy]-3,3-difluoropiperidin-1-yl]-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(N2CCC(OCc3c(-c4ccccc4OC(F)(F)F)noc3C3CC3)C(F)(F)C2)cc1 |
| InChI | InChI=1S/C26H25F5N4O4/c27-25(28)14-35(17-9-7-16(8-10-17)24(32)33-36)12-11-21(25)37-13-19-22(34-39-23(19)15-5-6-15)18-3-1-2-4-20(18)38-26(29,30)31/h1-4,7-10,15,21,36H,5-6,11-14H2,(H2,32,33) |
| InChIKey | KQXNHAAFIBYSGW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.50 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|