C26H27F3N4O4 — CID 164566531
4-[4-[[5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]methoxy]piperidin-1-yl]-N'-hydroxybenzenecarboximidamide (PubChem CID 164566531) has the molecular formula C26H27F3N4O4 and a molecular weight of 516.52 g/mol. Its IUPAC name is 4-[4-[[5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]methoxy]piperidin-1-yl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[4-[[5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]methoxy]piperidin-1-yl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 164566531 |
| Molecular Formula | C26H27F3N4O4 |
| Molecular Weight | 516.52 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 4-[4-[[5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]methoxy]piperidin-1-yl]-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N\O)c1ccc(N2CCC(OCc3c(-c4ccccc4OC(F)(F)F)noc3C3CC3)CC2)cc1 |
| InChI | InChI=1S/C26H27F3N4O4/c27-26(28,29)36-22-4-2-1-3-20(22)23-21(24(37-32-23)16-5-6-16)15-35-19-11-13-33(14-12-19)18-9-7-17(8-10-18)25(30)31-34/h1-4,7-10,16,19,34H,5-6,11-15H2,(H2,30,31) |
| InChIKey | RUOPRHDSUSPLDJ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|