C29H29F3N4O7 — CID 86710298
4-O-[[amino-[4-[[5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]methoxy]piperidin-1-yl]methylidene]amino] 1-O-methyl benzene-1,4-dicarboxylate (PubChem CID 86710298) has the molecular formula C29H29F3N4O7 and a molecular weight of 602.57 g/mol. Its IUPAC name is 4-O-[[amino-[4-[[5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]methoxy]piperidin-1-yl]methylidene]amino] 1-O-methyl benzene-1,4-dicarboxylate.
| Compound Name | 4-O-[[amino-[4-[[5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]methoxy]piperidin-1-yl]methylidene]amino] 1-O-methyl benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 86710298 |
| Molecular Formula | C29H29F3N4O7 |
| Molecular Weight | 602.57 g/mol |
| Exact Mass | 602.20 |
| IUPAC Name | 4-O-[[amino-[4-[[5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]methoxy]piperidin-1-yl]methylidene]amino] 1-O-methyl benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)ON=C(N)N2CCC(OCc3c(-c4ccccc4OC(F)(F)F)noc3C3CC3)CC2)cc1 |
| InChI | InChI=1S/C29H29F3N4O7/c1-39-26(37)18-8-10-19(11-9-18)27(38)43-35-28(33)36-14-12-20(13-15-36)40-16-22-24(34-42-25(22)17-6-7-17)21-4-2-3-5-23(21)41-29(30,31)32/h2-5,8-11,17,20H,6-7,12-16H2,1H3,(H2,33,35) |
| InChIKey | KXSDUSIHMYRJEV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 138.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|