C26H22Cl2F2N2O2 — CID 169227490
5-cyclopropyl-3-(2,6-dichlorophenyl)-4-[[1-(4-ethynylphenyl)-3,3-difluoropiperidin-4-yl]oxymethyl]-1,2-oxazole (PubChem CID 169227490) has the molecular formula C26H22Cl2F2N2O2 and a molecular weight of 503.38 g/mol. Its IUPAC name is 5-cyclopropyl-3-(2,6-dichlorophenyl)-4-[[1-(4-ethynylphenyl)-3,3-difluoropiperidin-4-yl]oxymethyl]-1,2-oxazole.
| Compound Name | 5-cyclopropyl-3-(2,6-dichlorophenyl)-4-[[1-(4-ethynylphenyl)-3,3-difluoropiperidin-4-yl]oxymethyl]-1,2-oxazole |
|---|---|
| PubChem CID | 169227490 |
| Molecular Formula | C26H22Cl2F2N2O2 |
| Molecular Weight | 503.38 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 5-cyclopropyl-3-(2,6-dichlorophenyl)-4-[[1-(4-ethynylphenyl)-3,3-difluoropiperidin-4-yl]oxymethyl]-1,2-oxazole |
| SMILES | C#Cc1ccc(N2CCC(OCc3c(-c4c(Cl)cccc4Cl)noc3C3CC3)C(F)(F)C2)cc1 |
| InChI | InChI=1S/C26H22Cl2F2N2O2/c1-2-16-6-10-18(11-7-16)32-13-12-22(26(29,30)15-32)33-14-19-24(31-34-25(19)17-8-9-17)23-20(27)4-3-5-21(23)28/h1,3-7,10-11,17,22H,8-9,12-15H2 |
| InChIKey | ZCLMBHCWYITVCY-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.38 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|