C25H23Cl2N3O2 — CID 171420462
5-cyclopropyl-3-(2,6-dichlorophenyl)-4-[[1-(4-isocyanophenyl)piperidin-4-yl]oxymethyl]-1,2-oxazole (PubChem CID 171420462) has the molecular formula C25H23Cl2N3O2 and a molecular weight of 468.38 g/mol. Its IUPAC name is 5-cyclopropyl-3-(2,6-dichlorophenyl)-4-[[1-(4-isocyanophenyl)piperidin-4-yl]oxymethyl]-1,2-oxazole.
| Compound Name | 5-cyclopropyl-3-(2,6-dichlorophenyl)-4-[[1-(4-isocyanophenyl)piperidin-4-yl]oxymethyl]-1,2-oxazole |
|---|---|
| PubChem CID | 171420462 |
| Molecular Formula | C25H23Cl2N3O2 |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 5-cyclopropyl-3-(2,6-dichlorophenyl)-4-[[1-(4-isocyanophenyl)piperidin-4-yl]oxymethyl]-1,2-oxazole |
| SMILES | [C-]#[N+]c1ccc(N2CCC(OCc3c(-c4c(Cl)cccc4Cl)noc3C3CC3)CC2)cc1 |
| InChI | InChI=1S/C25H23Cl2N3O2/c1-28-17-7-9-18(10-8-17)30-13-11-19(12-14-30)31-15-20-24(29-32-25(20)16-5-6-16)23-21(26)3-2-4-22(23)27/h2-4,7-10,16,19H,5-6,11-15H2 |
| InChIKey | ZALMPSWZNITIOG-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 42.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|