C25H26Cl2N4O3 — CID 167152034
4-[3-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]pyrrolidin-1-yl]-N'-methoxybenzenecarboximidamide (PubChem CID 167152034) has the molecular formula C25H26Cl2N4O3 and a molecular weight of 501.41 g/mol. Its IUPAC name is 4-[3-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]pyrrolidin-1-yl]-N'-methoxybenzenecarboximidamide.
| Compound Name | 4-[3-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]pyrrolidin-1-yl]-N'-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 167152034 |
| Molecular Formula | C25H26Cl2N4O3 |
| Molecular Weight | 501.41 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | 4-[3-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]pyrrolidin-1-yl]-N'-methoxybenzenecarboximidamide |
| SMILES | CO/N=C(\N)c1ccc(N2CCC(OCc3c(-c4c(Cl)cccc4Cl)noc3C3CC3)C2)cc1 |
| InChI | InChI=1S/C25H26Cl2N4O3/c1-32-30-25(28)16-7-9-17(10-8-16)31-12-11-18(13-31)33-14-19-23(29-34-24(19)15-5-6-15)22-20(26)3-2-4-21(22)27/h2-4,7-10,15,18H,5-6,11-14H2,1H3,(H2,28,30) |
| InChIKey | LYQVKHDBDYTUDE-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.41 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|