C23H22Cl2N4O3 — CID 174229518
4-[3-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]azetidin-1-yl]-N'-hydroxybenzenecarboximidamide (PubChem CID 174229518) has the molecular formula C23H22Cl2N4O3 and a molecular weight of 473.36 g/mol. Its IUPAC name is 4-[3-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]azetidin-1-yl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[3-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]azetidin-1-yl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 174229518 |
| Molecular Formula | C23H22Cl2N4O3 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 4-[3-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]azetidin-1-yl]-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(N2CC(OCc3c(-c4c(Cl)cccc4Cl)noc3C3CC3)C2)cc1 |
| InChI | InChI=1S/C23H22Cl2N4O3/c24-18-2-1-3-19(25)20(18)21-17(22(32-28-21)13-4-5-13)12-31-16-10-29(11-16)15-8-6-14(7-9-15)23(26)27-30/h1-3,6-9,13,16,30H,4-5,10-12H2,(H2,26,27) |
| InChIKey | BAJYCWQPRWHZTD-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|