C27H27Cl2FIN4O3- — CID 164566579
CID 164566579 (PubChem CID 164566579) has the molecular formula C27H27Cl2FIN4O3- and a molecular weight of 672.35 g/mol.
| Compound Name | CID 164566579 |
|---|---|
| PubChem CID | 164566579 |
| Molecular Formula | C27H27Cl2FIN4O3- |
| Molecular Weight | 672.35 g/mol |
| Exact Mass | 671.05 |
| IUPAC Name | — |
| SMILES | N/C(=N\O)C1(c2ccc(N3CCC(OCc4c(-c5c(Cl)cccc5Cl)noc4C4CC4)CC3)cc2F)C[I-]1 |
| InChI | InChI=1S/C27H27Cl2FIN4O3/c28-20-2-1-3-21(29)23(20)24-18(25(38-34-24)15-4-5-15)13-37-17-8-10-35(11-9-17)16-6-7-19(22(30)12-16)27(14-31-27)26(32)33-36/h1-3,6-7,12,15,17,36H,4-5,8-11,13-14H2,(H2,32,33)/q-1 |
| InChIKey | ISTWECBTFCKCCF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|