C27H27Cl2N3O4S — CID 145391560
5-[4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]piperidin-1-yl]-1-benzofuran-2-carbaldehyde;thiohydroxylamine (PubChem CID 145391560) has the molecular formula C27H27Cl2N3O4S and a molecular weight of 560.50 g/mol. Its IUPAC name is 5-[4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]piperidin-1-yl]-1-benzofuran-2-carbaldehyde;thiohydroxylamine.
| Compound Name | 5-[4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]piperidin-1-yl]-1-benzofuran-2-carbaldehyde;thiohydroxylamine |
|---|---|
| PubChem CID | 145391560 |
| Molecular Formula | C27H27Cl2N3O4S |
| Molecular Weight | 560.50 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | 5-[4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]piperidin-1-yl]-1-benzofuran-2-carbaldehyde;thiohydroxylamine |
| SMILES | NS.O=Cc1cc2cc(N3CCC(OCc4c(-c5c(Cl)cccc5Cl)noc4C4CC4)CC3)ccc2o1 |
| InChI | InChI=1S/C27H24Cl2N2O4.H3NS/c28-22-2-1-3-23(29)25(22)26-21(27(35-30-26)16-4-5-16)15-33-19-8-10-31(11-9-19)18-6-7-24-17(12-18)13-20(14-32)34-24;1-2/h1-3,6-7,12-14,16,19H,4-5,8-11,15H2;2H,1H2 |
| InChIKey | UMYIVCZVNSWLIK-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.50 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|