C28H25Cl2N3O4 — CID 142313128
2-[5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1,3-benzoxazole-6-carbaldehyde (PubChem CID 142313128) has the molecular formula C28H25Cl2N3O4 and a molecular weight of 538.43 g/mol. Its IUPAC name is 2-[5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1,3-benzoxazole-6-carbaldehyde.
| Compound Name | 2-[5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1,3-benzoxazole-6-carbaldehyde |
|---|---|
| PubChem CID | 142313128 |
| Molecular Formula | C28H25Cl2N3O4 |
| Molecular Weight | 538.43 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | 2-[5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1,3-benzoxazole-6-carbaldehyde |
| SMILES | O=Cc1ccc2nc(N3CC4CC(OCc5c(-c6c(Cl)cccc6Cl)noc5C5CC5)CC4C3)oc2c1 |
| InChI | InChI=1S/C28H25Cl2N3O4/c29-21-2-1-3-22(30)25(21)26-20(27(37-32-26)16-5-6-16)14-35-19-9-17-11-33(12-18(17)10-19)28-31-23-7-4-15(13-34)8-24(23)36-28/h1-4,7-8,13,16-19H,5-6,9-12,14H2 |
| InChIKey | YKKPOIQOSUHTBV-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 81.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.43 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|