C29H24Cl2N2O4S — CID 130388868
2-[(1R,2S,3R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-hydroxy-2-tricyclo[3.2.1.03,6]octanyl]-1,3-benzothiazole-6-carbaldehyde (PubChem CID 130388868) has the molecular formula C29H24Cl2N2O4S and a molecular weight of 567.49 g/mol. Its IUPAC name is 2-[(1R,2S,3R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-hydroxy-2-tricyclo[3.2.1.03,6]octanyl]-1,3-benzothiazole-6-carbaldehyde.
| Compound Name | 2-[(1R,2S,3R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-hydroxy-2-tricyclo[3.2.1.03,6]octanyl]-1,3-benzothiazole-6-carbaldehyde |
|---|---|
| PubChem CID | 130388868 |
| Molecular Formula | C29H24Cl2N2O4S |
| Molecular Weight | 567.49 g/mol |
| Exact Mass | 566.08 |
| IUPAC Name | 2-[(1R,2S,3R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-hydroxy-2-tricyclo[3.2.1.03,6]octanyl]-1,3-benzothiazole-6-carbaldehyde |
| SMILES | O=Cc1ccc2nc([C@]3(O)[C@@H]4CC5[C@H]3CC5(OCc3c(-c5c(Cl)cccc5Cl)noc3C3CC3)C4)sc2c1 |
| InChI | InChI=1S/C29H24Cl2N2O4S/c30-20-2-1-3-21(31)24(20)25-17(26(37-33-25)15-5-6-15)13-36-28-10-16-9-18(28)19(11-28)29(16,35)27-32-22-7-4-14(12-34)8-23(22)38-27/h1-4,7-8,12,15-16,18-19,35H,5-6,9-11,13H2/t16-,18?,19-,28?,29+/m1/s1 |
| InChIKey | KDEYZDWJWNHPGY-DLFBYOABSA-N |
| XLogP | 7.15 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.49 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|