C30H27Cl2N3O3S — CID 130388812
2-[(1R,3S,5R,6S,8S)-3-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-8-hydroxy-6-methyl-8-bicyclo[3.2.1]octanyl]-1,3-benzothiazole-6-carbonitrile (PubChem CID 130388812) has the molecular formula C30H27Cl2N3O3S and a molecular weight of 580.54 g/mol. Its IUPAC name is 2-[(1R,3S,5R,6S,8S)-3-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-8-hydroxy-6-methyl-8-bicyclo[3.2.1]octanyl]-1,3-benzothiazole-6-carbonitrile.
| Compound Name | 2-[(1R,3S,5R,6S,8S)-3-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-8-hydroxy-6-methyl-8-bicyclo[3.2.1]octanyl]-1,3-benzothiazole-6-carbonitrile |
|---|---|
| PubChem CID | 130388812 |
| Molecular Formula | C30H27Cl2N3O3S |
| Molecular Weight | 580.54 g/mol |
| Exact Mass | 579.12 |
| IUPAC Name | 2-[(1R,3S,5R,6S,8S)-3-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-8-hydroxy-6-methyl-8-bicyclo[3.2.1]octanyl]-1,3-benzothiazole-6-carbonitrile |
| SMILES | C[C@H]1C[C@@H]2C[C@H](OCc3c(-c4c(Cl)cccc4Cl)noc3C3CC3)C[C@H]1[C@]2(O)c1nc2ccc(C#N)cc2s1 |
| InChI | InChI=1S/C30H27Cl2N3O3S/c1-15-9-18-11-19(12-21(15)30(18,36)29-34-24-8-5-16(13-33)10-25(24)39-29)37-14-20-27(35-38-28(20)17-6-7-17)26-22(31)3-2-4-23(26)32/h2-5,8,10,15,17-19,21,36H,6-7,9,11-12,14H2,1H3/t15-,18+,19-,21+,30-/m0/s1 |
| InChIKey | GWSRYGYRDYUMJK-LWRFVAEMSA-N |
| XLogP | 7.85 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.54 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |