C29H28Cl2FNO5 — CID 130388860
4-[(1R,3R,5R,6S,8S)-3-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-8-hydroxy-6-methyl-8-bicyclo[3.2.1]octanyl]-3-fluorobenzoic acid (PubChem CID 130388860) has the molecular formula C29H28Cl2FNO5 and a molecular weight of 560.45 g/mol. Its IUPAC name is 4-[(1R,3R,5R,6S,8S)-3-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-8-hydroxy-6-methyl-8-bicyclo[3.2.1]octanyl]-3-fluorobenzoic acid.
| Compound Name | 4-[(1R,3R,5R,6S,8S)-3-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-8-hydroxy-6-methyl-8-bicyclo[3.2.1]octanyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 130388860 |
| Molecular Formula | C29H28Cl2FNO5 |
| Molecular Weight | 560.45 g/mol |
| Exact Mass | 559.13 |
| IUPAC Name | 4-[(1R,3R,5R,6S,8S)-3-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-8-hydroxy-6-methyl-8-bicyclo[3.2.1]octanyl]-3-fluorobenzoic acid |
| SMILES | C[C@H]1C[C@@H]2C[C@@H](OCc3c(-c4c(Cl)cccc4Cl)noc3C3CC3)C[C@H]1[C@]2(O)c1ccc(C(=O)O)cc1F |
| InChI | InChI=1S/C29H28Cl2FNO5/c1-14-9-17-11-18(12-21(14)29(17,36)20-8-7-16(28(34)35)10-24(20)32)37-13-19-26(33-38-27(19)15-5-6-15)25-22(30)3-2-4-23(25)31/h2-4,7-8,10,14-15,17-18,21,36H,5-6,9,11-13H2,1H3,(H,34,35)/t14-,17+,18+,21+,29+/m0/s1 |
| InChIKey | FZFMAQXKARXUJM-PIFFQOLYSA-N |
| XLogP | 7.20 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.45 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |