C28H28Cl2N2O5 — CID 130388695
2-[(1R,3R,5R,6S,8S)-3-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-8-hydroxy-6-methyl-8-bicyclo[3.2.1]octanyl]pyridine-4-carboxylic acid (PubChem CID 130388695) has the molecular formula C28H28Cl2N2O5 and a molecular weight of 543.45 g/mol. Its IUPAC name is 2-[(1R,3R,5R,6S,8S)-3-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-8-hydroxy-6-methyl-8-bicyclo[3.2.1]octanyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[(1R,3R,5R,6S,8S)-3-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-8-hydroxy-6-methyl-8-bicyclo[3.2.1]octanyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 130388695 |
| Molecular Formula | C28H28Cl2N2O5 |
| Molecular Weight | 543.45 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | 2-[(1R,3R,5R,6S,8S)-3-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-8-hydroxy-6-methyl-8-bicyclo[3.2.1]octanyl]pyridine-4-carboxylic acid |
| SMILES | C[C@H]1C[C@@H]2C[C@@H](OCc3c(-c4c(Cl)cccc4Cl)noc3C3CC3)C[C@H]1[C@]2(O)c1cc(C(=O)O)ccn1 |
| InChI | InChI=1S/C28H28Cl2N2O5/c1-14-9-17-11-18(12-20(14)28(17,35)23-10-16(27(33)34)7-8-31-23)36-13-19-25(32-37-26(19)15-5-6-15)24-21(29)3-2-4-22(24)30/h2-4,7-8,10,14-15,17-18,20,35H,5-6,9,11-13H2,1H3,(H,33,34)/t14-,17+,18+,20+,28-/m0/s1 |
| InChIKey | XWPHDPXCUDWXTF-GLEUFPFDSA-N |
| XLogP | 6.46 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.45 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |