C31H27Cl2N3O3S — CID 140726559
(1R,3S)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-(6-isocyano-1,3-benzothiazol-2-yl)adamantan-2-ol (PubChem CID 140726559) has the molecular formula C31H27Cl2N3O3S and a molecular weight of 592.55 g/mol. Its IUPAC name is (1R,3S)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-(6-isocyano-1,3-benzothiazol-2-yl)adamantan-2-ol.
| Compound Name | (1R,3S)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-(6-isocyano-1,3-benzothiazol-2-yl)adamantan-2-ol |
|---|---|
| PubChem CID | 140726559 |
| Molecular Formula | C31H27Cl2N3O3S |
| Molecular Weight | 592.55 g/mol |
| Exact Mass | 591.12 |
| IUPAC Name | (1R,3S)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-(6-isocyano-1,3-benzothiazol-2-yl)adamantan-2-ol |
| SMILES | [C-]#[N+]c1ccc2nc(C3(O)[C@@H]4CC5C[C@H]3CC(OCc3c(-c6c(Cl)cccc6Cl)noc3C3CC3)(C5)C4)sc2c1 |
| InChI | InChI=1S/C31H27Cl2N3O3S/c1-34-20-7-8-24-25(11-20)40-29(35-24)31(37)18-9-16-10-19(31)14-30(12-16,13-18)38-15-21-27(36-39-28(21)17-5-6-17)26-22(32)3-2-4-23(26)33/h2-4,7-8,11,16-19,37H,5-6,9-10,12-15H2/t16?,18-,19+,30?,31? |
| InChIKey | SABUVFKNOSNALC-ZYAZHIEHSA-N |
| XLogP | 8.67 |
| TPSA | 72.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.55 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|