C31H29Cl2N3O4 — CID 142312771
methyl 2-[5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]quinoline-6-carboxylate (PubChem CID 142312771) has the molecular formula C31H29Cl2N3O4 and a molecular weight of 578.50 g/mol. Its IUPAC name is methyl 2-[5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]quinoline-6-carboxylate.
| Compound Name | methyl 2-[5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]quinoline-6-carboxylate |
|---|---|
| PubChem CID | 142312771 |
| Molecular Formula | C31H29Cl2N3O4 |
| Molecular Weight | 578.50 g/mol |
| Exact Mass | 577.15 |
| IUPAC Name | methyl 2-[5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]quinoline-6-carboxylate |
| SMILES | COC(=O)c1ccc2nc(N3CC4CC(OCc5c(-c6c(Cl)cccc6Cl)noc5C5CC5)CC4C3)ccc2c1 |
| InChI | InChI=1S/C31H29Cl2N3O4/c1-38-31(37)19-7-9-26-18(11-19)8-10-27(34-26)36-14-20-12-22(13-21(20)15-36)39-16-23-29(35-40-30(23)17-5-6-17)28-24(32)3-2-4-25(28)33/h2-4,7-11,17,20-22H,5-6,12-16H2,1H3 |
| InChIKey | ZNSSASRVCSZVDT-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.50 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |