C31H34Cl2N4O4 — CID 142313036
methyl 4-[[(3aR)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methyl-methylamino]-3-(methylideneamino)benzoate (PubChem CID 142313036) has the molecular formula C31H34Cl2N4O4 and a molecular weight of 597.54 g/mol. Its IUPAC name is methyl 4-[[(3aR)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methyl-methylamino]-3-(methylideneamino)benzoate.
| Compound Name | methyl 4-[[(3aR)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methyl-methylamino]-3-(methylideneamino)benzoate |
|---|---|
| PubChem CID | 142313036 |
| Molecular Formula | C31H34Cl2N4O4 |
| Molecular Weight | 597.54 g/mol |
| Exact Mass | 596.20 |
| IUPAC Name | methyl 4-[[(3aR)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methyl-methylamino]-3-(methylideneamino)benzoate |
| SMILES | C=Nc1cc(C(=O)OC)ccc1N(C)CN1CC2CC(OCc3c(-c4c(Cl)cccc4Cl)noc3C3CC3)C[C@H]2C1 |
| InChI | InChI=1S/C31H34Cl2N4O4/c1-34-26-13-19(31(38)39-3)9-10-27(26)36(2)17-37-14-20-11-22(12-21(20)15-37)40-16-23-29(35-41-30(23)18-7-8-18)28-24(32)5-4-6-25(28)33/h4-6,9-10,13,18,20-22H,1,7-8,11-12,14-17H2,2-3H3/t20-,21?,22?/m0/s1 |
| InChIKey | HEVZNXSYXZPJDW-HWELCPFYSA-N |
| XLogP | 6.97 |
| TPSA | 80.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.54 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|