C25H27Cl2N5O3 — CID 174229209
6-[(2R,4R)-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-methylpiperidin-1-yl]-N'-hydroxypyridine-3-carboximidamide (PubChem CID 174229209) has the molecular formula C25H27Cl2N5O3 and a molecular weight of 516.43 g/mol. Its IUPAC name is 6-[(2R,4R)-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-methylpiperidin-1-yl]-N'-hydroxypyridine-3-carboximidamide.
| Compound Name | 6-[(2R,4R)-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-methylpiperidin-1-yl]-N'-hydroxypyridine-3-carboximidamide |
|---|---|
| PubChem CID | 174229209 |
| Molecular Formula | C25H27Cl2N5O3 |
| Molecular Weight | 516.43 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | 6-[(2R,4R)-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-methylpiperidin-1-yl]-N'-hydroxypyridine-3-carboximidamide |
| SMILES | C[C@@H]1C[C@H](OCc2c(-c3c(Cl)cccc3Cl)noc2C2CC2)CCN1c1ccc(C(N)=NO)cn1 |
| InChI | InChI=1S/C25H27Cl2N5O3/c1-14-11-17(9-10-32(14)21-8-7-16(12-29-21)25(28)30-33)34-13-18-23(31-35-24(18)15-5-6-15)22-19(26)3-2-4-20(22)27/h2-4,7-8,12,14-15,17,33H,5-6,9-11,13H2,1H3,(H2,28,30)/t14-,17-/m1/s1 |
| InChIKey | HRLXSNZIAQLGSM-RHSMWYFYSA-N |
| XLogP | 5.59 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.43 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|