C26H27Cl2N5O4 — CID 167152076
[[C-[6-[4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]piperidin-1-yl]-3-pyridinyl]-N-methylcarbonimidoyl]amino] formate (PubChem CID 167152076) has the molecular formula C26H27Cl2N5O4 and a molecular weight of 544.44 g/mol. Its IUPAC name is [[C-[6-[4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]piperidin-1-yl]-3-pyridinyl]-N-methylcarbonimidoyl]amino] formate.
| Compound Name | [[C-[6-[4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]piperidin-1-yl]-3-pyridinyl]-N-methylcarbonimidoyl]amino] formate |
|---|---|
| PubChem CID | 167152076 |
| Molecular Formula | C26H27Cl2N5O4 |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | [[C-[6-[4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]piperidin-1-yl]-3-pyridinyl]-N-methylcarbonimidoyl]amino] formate |
| SMILES | C/N=C(\NOC=O)c1ccc(N2CCC(OCc3c(-c4c(Cl)cccc4Cl)noc3C3CC3)CC2)nc1 |
| InChI | InChI=1S/C26H27Cl2N5O4/c1-29-26(32-36-15-34)17-7-8-22(30-13-17)33-11-9-18(10-12-33)35-14-19-24(31-37-25(19)16-5-6-16)23-20(27)3-2-4-21(23)28/h2-4,7-8,13,15-16,18H,5-6,9-12,14H2,1H3,(H,29,32) |
| InChIKey | GYCDJUCRXJAYHN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 102.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|