C28H37Cl2N5O4Si — CID 169227567
3-[4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]piperidin-1-yl]-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carboxamide (PubChem CID 169227567) has the molecular formula C28H37Cl2N5O4Si and a molecular weight of 606.63 g/mol. Its IUPAC name is 3-[4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]piperidin-1-yl]-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carboxamide.
| Compound Name | 3-[4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]piperidin-1-yl]-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 169227567 |
| Molecular Formula | C28H37Cl2N5O4Si |
| Molecular Weight | 606.63 g/mol |
| Exact Mass | 605.20 |
| IUPAC Name | 3-[4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]piperidin-1-yl]-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1nc(N2CCC(OCc3c(-c4c(Cl)cccc4Cl)noc3C3CC3)CC2)cc1C(N)=O |
| InChI | InChI=1S/C28H37Cl2N5O4Si/c1-40(2,3)14-13-37-17-35-23(28(31)36)15-24(32-35)34-11-9-19(10-12-34)38-16-20-26(33-39-27(20)18-7-8-18)25-21(29)5-4-6-22(25)30/h4-6,15,18-19H,7-14,16-17H2,1-3H3,(H2,31,36) |
| InChIKey | JMAJHPKIPMQFCA-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.63 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|