C26H26Cl2N6O4 — CID 171902568
6-[6-[4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]piperidin-1-yl]-3-pyridinyl]-1,2,4-triazinane-3,5-dione (PubChem CID 171902568) has the molecular formula C26H26Cl2N6O4 and a molecular weight of 557.44 g/mol. Its IUPAC name is 6-[6-[4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]piperidin-1-yl]-3-pyridinyl]-1,2,4-triazinane-3,5-dione.
| Compound Name | 6-[6-[4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]piperidin-1-yl]-3-pyridinyl]-1,2,4-triazinane-3,5-dione |
|---|---|
| PubChem CID | 171902568 |
| Molecular Formula | C26H26Cl2N6O4 |
| Molecular Weight | 557.44 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | 6-[6-[4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]piperidin-1-yl]-3-pyridinyl]-1,2,4-triazinane-3,5-dione |
| SMILES | O=C1NNC(c2ccc(N3CCC(OCc4c(-c5c(Cl)cccc5Cl)noc4C4CC4)CC3)nc2)C(=O)N1 |
| InChI | InChI=1S/C26H26Cl2N6O4/c27-18-2-1-3-19(28)21(18)23-17(24(38-33-23)14-4-5-14)13-37-16-8-10-34(11-9-16)20-7-6-15(12-29-20)22-25(35)30-26(36)32-31-22/h1-3,6-7,12,14,16,22,31H,4-5,8-11,13H2,(H2,30,32,35,36) |
| InChIKey | CZPXIWOWIQVGEO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |