C29H24Cl2N2O4 — CID 130366929
3-[1-[4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]phenyl]azetidin-3-yl]benzoic acid (PubChem CID 130366929) has the molecular formula C29H24Cl2N2O4 and a molecular weight of 535.43 g/mol. Its IUPAC name is 3-[1-[4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]phenyl]azetidin-3-yl]benzoic acid.
| Compound Name | 3-[1-[4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]phenyl]azetidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 130366929 |
| Molecular Formula | C29H24Cl2N2O4 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | 3-[1-[4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]phenyl]azetidin-3-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(C2CN(c3ccc(OCc4c(-c5c(Cl)cccc5Cl)noc4C4CC4)cc3)C2)c1 |
| InChI | InChI=1S/C29H24Cl2N2O4/c30-24-5-2-6-25(31)26(24)27-23(28(37-32-27)17-7-8-17)16-36-22-11-9-21(10-12-22)33-14-20(15-33)18-3-1-4-19(13-18)29(34)35/h1-6,9-13,17,20H,7-8,14-16H2,(H,34,35) |
| InChIKey | QRVDMMHKBUGGTF-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|