C30H25Cl2NO7 — CID 139315773
6-[[(3R,3aR,6R,6aR)-3-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]naphthalene-2-carboxylic acid (PubChem CID 139315773) has the molecular formula C30H25Cl2NO7 and a molecular weight of 582.44 g/mol. Its IUPAC name is 6-[[(3R,3aR,6R,6aR)-3-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]naphthalene-2-carboxylic acid.
| Compound Name | 6-[[(3R,3aR,6R,6aR)-3-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 139315773 |
| Molecular Formula | C30H25Cl2NO7 |
| Molecular Weight | 582.44 g/mol |
| Exact Mass | 581.10 |
| IUPAC Name | 6-[[(3R,3aR,6R,6aR)-3-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]naphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2cc(O[C@@H]3CO[C@H]4[C@@H]3OC[C@H]4OCc3c(-c4c(Cl)cccc4Cl)noc3C3CC3)ccc2c1 |
| InChI | InChI=1S/C30H25Cl2NO7/c31-21-2-1-3-22(32)25(21)26-20(27(40-33-26)15-4-5-15)12-36-23-13-37-29-24(14-38-28(23)29)39-19-9-8-16-10-18(30(34)35)7-6-17(16)11-19/h1-3,6-11,15,23-24,28-29H,4-5,12-14H2,(H,34,35)/t23-,24-,28-,29-/m1/s1 |
| InChIKey | MHEKKBDAVWKXIS-ALMNYQQGSA-N |
| XLogP | 6.51 |
| TPSA | 100.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.44 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |