C28H21Cl3N2O5 — CID 50942930
3-[2-[2-chloro-4-[[5-cyclopropyl-3-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1,2-oxazol-4-yl]methoxy]phenyl]cyclopropyl]benzoic acid (PubChem CID 50942930) has the molecular formula C28H21Cl3N2O5 and a molecular weight of 571.84 g/mol. Its IUPAC name is 3-[2-[2-chloro-4-[[5-cyclopropyl-3-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1,2-oxazol-4-yl]methoxy]phenyl]cyclopropyl]benzoic acid.
| Compound Name | 3-[2-[2-chloro-4-[[5-cyclopropyl-3-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1,2-oxazol-4-yl]methoxy]phenyl]cyclopropyl]benzoic acid |
|---|---|
| PubChem CID | 50942930 |
| Molecular Formula | C28H21Cl3N2O5 |
| Molecular Weight | 571.84 g/mol |
| Exact Mass | 570.05 |
| IUPAC Name | 3-[2-[2-chloro-4-[[5-cyclopropyl-3-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1,2-oxazol-4-yl]methoxy]phenyl]cyclopropyl]benzoic acid |
| SMILES | O=C(O)c1cccc(C2CC2c2ccc(OCc3c(-c4c(Cl)c[n+]([O-])cc4Cl)noc3C3CC3)cc2Cl)c1 |
| InChI | InChI=1S/C28H21Cl3N2O5/c29-22-9-17(6-7-18(22)20-10-19(20)15-2-1-3-16(8-15)28(34)35)37-13-21-26(32-38-27(21)14-4-5-14)25-23(30)11-33(36)12-24(25)31/h1-3,6-9,11-12,14,19-20H,4-5,10,13H2,(H,34,35) |
| InChIKey | BQBDJFNBRFNQPC-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.84 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|