C8H18N4O2S — CID 137402450
3-[aminooxysulfanyl(methyl)amino]-N,N-dimethylpyrrolidine-1-carboxamide (PubChem CID 137402450) has the molecular formula C8H18N4O2S and a molecular weight of 234.32 g/mol. Its IUPAC name is 3-[aminooxysulfanyl(methyl)amino]-N,N-dimethylpyrrolidine-1-carboxamide.
| Compound Name | 3-[aminooxysulfanyl(methyl)amino]-N,N-dimethylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 137402450 |
| Molecular Formula | C8H18N4O2S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 3-[aminooxysulfanyl(methyl)amino]-N,N-dimethylpyrrolidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCC(N(C)SON)C1 |
| InChI | InChI=1S/C8H18N4O2S/c1-10(2)8(13)12-5-4-7(6-12)11(3)15-14-9/h7H,4-6,9H2,1-3H3 |
| InChIKey | WIXXQTXTBGPQSY-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|