C21H25N3O4S — CID 137402561
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(2-oxo-1-propan-2-yl-3-pyridinyl)sulfonyl]urea (PubChem CID 137402561) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(2-oxo-1-propan-2-yl-3-pyridinyl)sulfonyl]urea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(2-oxo-1-propan-2-yl-3-pyridinyl)sulfonyl]urea |
|---|---|
| PubChem CID | 137402561 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(2-oxo-1-propan-2-yl-3-pyridinyl)sulfonyl]urea |
| SMILES | CC(C)n1cccc(S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)c1=O |
| InChI | InChI=1S/C21H25N3O4S/c1-13(2)24-11-5-10-18(20(24)25)29(27,28)23-21(26)22-19-16-8-3-6-14(16)12-15-7-4-9-17(15)19/h5,10-13H,3-4,6-9H2,1-2H3,(H2,22,23,26) |
| InChIKey | YMLKSFIVQZZVOJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |