C17H20N4O3S2 — CID 137403349
2-(3-ethylsulfonyl-5-propan-2-yloxy-2-pyridinyl)-3-methyl-5H-imidazo[4,5-c]pyridine-6-thione (PubChem CID 137403349) has the molecular formula C17H20N4O3S2 and a molecular weight of 392.51 g/mol. Its IUPAC name is 2-(3-ethylsulfonyl-5-propan-2-yloxy-2-pyridinyl)-3-methyl-5H-imidazo[4,5-c]pyridine-6-thione.
| Compound Name | 2-(3-ethylsulfonyl-5-propan-2-yloxy-2-pyridinyl)-3-methyl-5H-imidazo[4,5-c]pyridine-6-thione |
|---|---|
| PubChem CID | 137403349 |
| Molecular Formula | C17H20N4O3S2 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 2-(3-ethylsulfonyl-5-propan-2-yloxy-2-pyridinyl)-3-methyl-5H-imidazo[4,5-c]pyridine-6-thione |
| SMILES | CCS(=O)(=O)c1cc(OC(C)C)cnc1-c1nc2cc(=S)[nH]cc2n1C |
| InChI | InChI=1S/C17H20N4O3S2/c1-5-26(22,23)14-6-11(24-10(2)3)8-19-16(14)17-20-12-7-15(25)18-9-13(12)21(17)4/h6-10H,5H2,1-4H3,(H,18,25) |
| InChIKey | HGPDFXWGCSXPSI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|