C12H17N2O5S- — CID 137403485
[4-[2-(dimethylamino)ethylcarbamoyloxymethyl]phenyl] sulfite (PubChem CID 137403485) has the molecular formula C12H17N2O5S- and a molecular weight of 301.34 g/mol. Its IUPAC name is [4-[2-(dimethylamino)ethylcarbamoyloxymethyl]phenyl] sulfite.
| Compound Name | [4-[2-(dimethylamino)ethylcarbamoyloxymethyl]phenyl] sulfite |
|---|---|
| PubChem CID | 137403485 |
| Molecular Formula | C12H17N2O5S- |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | [4-[2-(dimethylamino)ethylcarbamoyloxymethyl]phenyl] sulfite |
| SMILES | CN(C)CCNC(=O)OCc1ccc(OS(=O)[O-])cc1 |
| InChI | InChI=1S/C12H18N2O5S/c1-14(2)8-7-13-12(15)18-9-10-3-5-11(6-4-10)19-20(16)17/h3-6H,7-9H2,1-2H3,(H,13,15)(H,16,17)/p-1 |
| InChIKey | UUEIYBHZUAJOQE-UHFFFAOYSA-M |
| XLogP | 0.65 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|