About 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-(6-piperazin-1-ylpyrazin-2-yl)sulfonylurea
1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-(6-piperazin-1-ylpyrazin-2-yl)sulfonylurea (PubChem CID 137404281) has the molecular formula C21H29FN6O3S
and a molecular weight of 464.57 g/mol. Its IUPAC name is 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-(6-piperazin-1-ylpyrazin-2-yl)sulfonylurea.
Molecular Properties
| Compound Name | 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-(6-piperazin-1-ylpyrazin-2-yl)sulfonylurea |
| PubChem CID | 137404281 |
| Molecular Formula | C21H29FN6O3S |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-(6-piperazin-1-ylpyrazin-2-yl)sulfonylurea |
| SMILES | CC(C)c1cc(F)cc(C(C)C)c1NC(=O)NS(=O)(=O)c1cncc(N2CCNCC2)n1 |
| InChI | InChI=1S/C21H29FN6O3S/c1-13(2)16-9-15(22)10-17(14(3)4)20(16)26-21(29)27-32(30,31)19-12-24-11-18(25-19)28-7-5-23-6-8-28/h9-14,23H,5-8H2,1-4H3,(H2,26,27,29) |
| InChIKey | RVJHHMQIUPIJQQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-(6-piperazin-1-ylpyrazin-2-yl)sulfonylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-(6-piperazin-1-ylpyrazin-2-yl)sulfonylurea?
The IUPAC name of 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-(6-piperazin-1-ylpyrazin-2-yl)sulfonylurea (CID 137404281) is 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-(6-piperazin-1-ylpyrazin-2-yl)sulfonylurea.
What is the SMILES notation for 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-(6-piperazin-1-ylpyrazin-2-yl)sulfonylurea?
The canonical SMILES for 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-(6-piperazin-1-ylpyrazin-2-yl)sulfonylurea is CC(C)c1cc(F)cc(C(C)C)c1NC(=O)NS(=O)(=O)c1cncc(N2CCNCC2)n1.
What is the InChIKey of 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-(6-piperazin-1-ylpyrazin-2-yl)sulfonylurea?
The InChIKey is RVJHHMQIUPIJQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29FN6O3S/c1-13(2)16-9-15(22)10-17(14(3)4)20(16)26-21(29)27-32(30,31)19-12-24-11-18(25-19)28-7-5-23-6-8-28/h9-14,23H,5-8H2,1-4H3,(H2,26,27,29).
What are the key properties of 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-(6-piperazin-1-ylpyrazin-2-yl)sulfonylurea?
1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-(6-piperazin-1-ylpyrazin-2-yl)sulfonylurea has a molecular weight of 464.57 g/mol, XLogP of 2.78, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-(6-piperazin-1-ylpyrazin-2-yl)sulfonylurea is sourced from PubChem (CID 137404281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).