C11H9F3N6O2 — CID 137405477
3-azido-N-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-2-hydroxy-2-methylpropanamide (PubChem CID 137405477) has the molecular formula C11H9F3N6O2 and a molecular weight of 314.23 g/mol. Its IUPAC name is 3-azido-N-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-2-hydroxy-2-methylpropanamide.
| Compound Name | 3-azido-N-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 137405477 |
| Molecular Formula | C11H9F3N6O2 |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 3-azido-N-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-2-hydroxy-2-methylpropanamide |
| SMILES | CC(O)(CN=[N+]=[N-])C(=O)Nc1cnc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H9F3N6O2/c1-10(22,5-18-20-16)9(21)19-6-2-7(11(12,13)14)8(3-15)17-4-6/h2,4,22H,5H2,1H3,(H,19,21) |
| InChIKey | JXCMBYDSLDVYNT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 134.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|