C12H14F3N4OP — CID 137445272
N-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-2-(phosphanylamino)pentanamide (PubChem CID 137445272) has the molecular formula C12H14F3N4OP and a molecular weight of 318.24 g/mol. Its IUPAC name is N-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-2-(phosphanylamino)pentanamide.
| Compound Name | N-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-2-(phosphanylamino)pentanamide |
|---|---|
| PubChem CID | 137445272 |
| Molecular Formula | C12H14F3N4OP |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | N-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-2-(phosphanylamino)pentanamide |
| SMILES | CCCC(NP)C(=O)Nc1cnc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3N4OP/c1-2-3-9(19-21)11(20)18-7-4-8(12(13,14)15)10(5-16)17-6-7/h4,6,9,19H,2-3,21H2,1H3,(H,18,20) |
| InChIKey | QPBYBUJZMLXMMB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|