C15H16F3N3O2 — CID 162681755
ethyl 1-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]piperidine-4-carboxylate (PubChem CID 162681755) has the molecular formula C15H16F3N3O2 and a molecular weight of 327.31 g/mol. Its IUPAC name is ethyl 1-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 162681755 |
| Molecular Formula | C15H16F3N3O2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | ethyl 1-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2cnc(C#N)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C15H16F3N3O2/c1-2-23-14(22)10-3-5-21(6-4-10)11-7-12(15(16,17)18)13(8-19)20-9-11/h7,9-10H,2-6H2,1H3 |
| InChIKey | ZMSMFIXCPHLCSJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |