C19H11F3N4OS — CID 151019291
N-[[6-cyano-5-(trifluoromethyl)-3-pyridinyl]carbamothioyl]naphthalene-1-carboxamide (PubChem CID 151019291) has the molecular formula C19H11F3N4OS and a molecular weight of 400.39 g/mol. Its IUPAC name is N-[[6-cyano-5-(trifluoromethyl)-3-pyridinyl]carbamothioyl]naphthalene-1-carboxamide.
| Compound Name | N-[[6-cyano-5-(trifluoromethyl)-3-pyridinyl]carbamothioyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 151019291 |
| Molecular Formula | C19H11F3N4OS |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | N-[[6-cyano-5-(trifluoromethyl)-3-pyridinyl]carbamothioyl]naphthalene-1-carboxamide |
| SMILES | N#Cc1ncc(NC(=S)NC(=O)c2cccc3ccccc23)cc1C(F)(F)F |
| InChI | InChI=1S/C19H11F3N4OS/c20-19(21,22)15-8-12(10-24-16(15)9-23)25-18(28)26-17(27)14-7-3-5-11-4-1-2-6-13(11)14/h1-8,10H,(H2,25,26,27,28) |
| InChIKey | LXSTXBFAQFUMFX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|