C37H31FN2O2 — CID 137406299
(2E)-2-[[4-fluoro-2-(1-tritylimidazol-4-yl)phenyl]methylidene]-7-oxaspiro[3.5]nonan-3-one (PubChem CID 137406299) has the molecular formula C37H31FN2O2 and a molecular weight of 554.67 g/mol. Its IUPAC name is (2E)-2-[[4-fluoro-2-(1-tritylimidazol-4-yl)phenyl]methylidene]-7-oxaspiro[3.5]nonan-3-one.
| Compound Name | (2E)-2-[[4-fluoro-2-(1-tritylimidazol-4-yl)phenyl]methylidene]-7-oxaspiro[3.5]nonan-3-one |
|---|---|
| PubChem CID | 137406299 |
| Molecular Formula | C37H31FN2O2 |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | (2E)-2-[[4-fluoro-2-(1-tritylimidazol-4-yl)phenyl]methylidene]-7-oxaspiro[3.5]nonan-3-one |
| SMILES | O=C1/C(=C/c2ccc(F)cc2-c2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn2)CC12CCOCC2 |
| InChI | InChI=1S/C37H31FN2O2/c38-32-17-16-27(22-28-24-36(35(28)41)18-20-42-21-19-36)33(23-32)34-25-40(26-39-34)37(29-10-4-1-5-11-29,30-12-6-2-7-13-30)31-14-8-3-9-15-31/h1-17,22-23,25-26H,18-21,24H2/b28-22+ |
| InChIKey | MWRVUYJZICRIKA-XAYXJRQQSA-N |
| XLogP | 7.68 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|