C35H33F4N7O2 — CID 137407147
1-[5-[4-[4-[4-[cyclopropyl(hydroxy)methyl]phenyl]piperazin-1-yl]phenyl]-2-pyridinyl]-2-(2,4-difluorophenyl)-1,1-difluoro-3-(tetrazol-1-yl)propan-2-ol (PubChem CID 137407147) has the molecular formula C35H33F4N7O2 and a molecular weight of 659.69 g/mol. Its IUPAC name is 1-[5-[4-[4-[4-[cyclopropyl(hydroxy)methyl]phenyl]piperazin-1-yl]phenyl]-2-pyridinyl]-2-(2,4-difluorophenyl)-1,1-difluoro-3-(tetrazol-1-yl)propan-2-ol.
| Compound Name | 1-[5-[4-[4-[4-[cyclopropyl(hydroxy)methyl]phenyl]piperazin-1-yl]phenyl]-2-pyridinyl]-2-(2,4-difluorophenyl)-1,1-difluoro-3-(tetrazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 137407147 |
| Molecular Formula | C35H33F4N7O2 |
| Molecular Weight | 659.69 g/mol |
| Exact Mass | 659.26 |
| IUPAC Name | 1-[5-[4-[4-[4-[cyclopropyl(hydroxy)methyl]phenyl]piperazin-1-yl]phenyl]-2-pyridinyl]-2-(2,4-difluorophenyl)-1,1-difluoro-3-(tetrazol-1-yl)propan-2-ol |
| SMILES | OC(c1ccc(N2CCN(c3ccc(-c4ccc(C(F)(F)C(O)(Cn5cnnn5)c5ccc(F)cc5F)nc4)cc3)CC2)cc1)C1CC1 |
| InChI | InChI=1S/C35H33F4N7O2/c36-27-8-13-30(31(37)19-27)34(48,21-46-22-41-42-43-46)35(38,39)32-14-7-26(20-40-32)23-3-9-28(10-4-23)44-15-17-45(18-16-44)29-11-5-25(6-12-29)33(47)24-1-2-24/h3-14,19-20,22,24,33,47-48H,1-2,15-18,21H2 |
| InChIKey | GDPJPMRNHGANPM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.69 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|