C34H29F7N6O2 — CID 142747067
(2R)-2-(2,4-difluorophenyl)-1,1-difluoro-3-(1,2,4-triazol-4-yl)-1-[5-[4-[4-[4-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]piperazin-1-yl]phenyl]-2-pyridinyl]propan-2-ol (PubChem CID 142747067) has the molecular formula C34H29F7N6O2 and a molecular weight of 686.63 g/mol. Its IUPAC name is (2R)-2-(2,4-difluorophenyl)-1,1-difluoro-3-(1,2,4-triazol-4-yl)-1-[5-[4-[4-[4-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]piperazin-1-yl]phenyl]-2-pyridinyl]propan-2-ol.
| Compound Name | (2R)-2-(2,4-difluorophenyl)-1,1-difluoro-3-(1,2,4-triazol-4-yl)-1-[5-[4-[4-[4-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]piperazin-1-yl]phenyl]-2-pyridinyl]propan-2-ol |
|---|---|
| PubChem CID | 142747067 |
| Molecular Formula | C34H29F7N6O2 |
| Molecular Weight | 686.63 g/mol |
| Exact Mass | 686.22 |
| IUPAC Name | (2R)-2-(2,4-difluorophenyl)-1,1-difluoro-3-(1,2,4-triazol-4-yl)-1-[5-[4-[4-[4-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]piperazin-1-yl]phenyl]-2-pyridinyl]propan-2-ol |
| SMILES | O[C@H](c1ccc(N2CCN(c3ccc(-c4ccc(C(F)(F)[C@](O)(Cn5cnnc5)c5ccc(F)cc5F)nc4)cc3)CC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C34H29F7N6O2/c35-25-6-11-28(29(36)17-25)32(49,19-45-20-43-44-21-45)33(37,38)30-12-5-24(18-42-30)22-1-7-26(8-2-22)46-13-15-47(16-14-46)27-9-3-23(4-10-27)31(48)34(39,40)41/h1-12,17-18,20-21,31,48-49H,13-16,19H2/t31-,32+/m1/s1 |
| InChIKey | HAWNZENDCHYEQZ-ZWXJPIIXSA-N |
| XLogP | 6.22 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.63 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|