C14H13F4N3 — CID 137408268
(5R,7R)-7-fluoro-5-phenyl-2-(3,3,3-trifluoropropyl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 137408268) has the molecular formula C14H13F4N3 and a molecular weight of 299.27 g/mol. Its IUPAC name is (5R,7R)-7-fluoro-5-phenyl-2-(3,3,3-trifluoropropyl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | (5R,7R)-7-fluoro-5-phenyl-2-(3,3,3-trifluoropropyl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 137408268 |
| Molecular Formula | C14H13F4N3 |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | (5R,7R)-7-fluoro-5-phenyl-2-(3,3,3-trifluoropropyl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | F[C@@H]1C[C@H](c2ccccc2)n2nc(CCC(F)(F)F)nc21 |
| InChI | InChI=1S/C14H13F4N3/c15-10-8-11(9-4-2-1-3-5-9)21-13(10)19-12(20-21)6-7-14(16,17)18/h1-5,10-11H,6-8H2/t10-,11-/m1/s1 |
| InChIKey | UNGACTKJXUJRLY-GHMZBOCLSA-N |
| XLogP | 3.78 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |