C17H16ClFN4O — CID 137409052
4-chloro-6-fluoro-7-[2-(oxan-2-yl)pyrazol-3-yl]quinolin-2-amine (PubChem CID 137409052) has the molecular formula C17H16ClFN4O and a molecular weight of 346.79 g/mol. Its IUPAC name is 4-chloro-6-fluoro-7-[2-(oxan-2-yl)pyrazol-3-yl]quinolin-2-amine.
| Compound Name | 4-chloro-6-fluoro-7-[2-(oxan-2-yl)pyrazol-3-yl]quinolin-2-amine |
|---|---|
| PubChem CID | 137409052 |
| Molecular Formula | C17H16ClFN4O |
| Molecular Weight | 346.79 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 4-chloro-6-fluoro-7-[2-(oxan-2-yl)pyrazol-3-yl]quinolin-2-amine |
| SMILES | Nc1cc(Cl)c2cc(F)c(-c3ccnn3C3CCCCO3)cc2n1 |
| InChI | InChI=1S/C17H16ClFN4O/c18-12-9-16(20)22-14-8-11(13(19)7-10(12)14)15-4-5-21-23(15)17-3-1-2-6-24-17/h4-5,7-9,17H,1-3,6H2,(H2,20,22) |
| InChIKey | UCRPDNOTIQNXDZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.79 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |