C24H24FN7O — CID 137412144
3-[2-fluoro-4-[3-(pyridin-2-ylamino)oxiran-2-yl]phenyl]-1-[(3R)-piperidin-3-yl]pyrazolo[4,3-c]pyridin-4-amine (PubChem CID 137412144) has the molecular formula C24H24FN7O and a molecular weight of 445.50 g/mol. Its IUPAC name is 3-[2-fluoro-4-[3-(pyridin-2-ylamino)oxiran-2-yl]phenyl]-1-[(3R)-piperidin-3-yl]pyrazolo[4,3-c]pyridin-4-amine.
| Compound Name | 3-[2-fluoro-4-[3-(pyridin-2-ylamino)oxiran-2-yl]phenyl]-1-[(3R)-piperidin-3-yl]pyrazolo[4,3-c]pyridin-4-amine |
|---|---|
| PubChem CID | 137412144 |
| Molecular Formula | C24H24FN7O |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 3-[2-fluoro-4-[3-(pyridin-2-ylamino)oxiran-2-yl]phenyl]-1-[(3R)-piperidin-3-yl]pyrazolo[4,3-c]pyridin-4-amine |
| SMILES | Nc1nccc2c1c(-c1ccc(C3OC3Nc3ccccn3)cc1F)nn2[C@@H]1CCCNC1 |
| InChI | InChI=1S/C24H24FN7O/c25-17-12-14(22-24(33-22)30-19-5-1-2-10-28-19)6-7-16(17)21-20-18(8-11-29-23(20)26)32(31-21)15-4-3-9-27-13-15/h1-2,5-8,10-12,15,22,24,27H,3-4,9,13H2,(H2,26,29)(H,28,30)/t15-,22?,24?/m1/s1 |
| InChIKey | BXZYZYPVCCIQSL-YUYVHZINSA-N |
| XLogP | 3.65 |
| TPSA | 106.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|