C19H16FN3OS — CID 1374135
2-(2,3-dimethyl-1H-indol-5-yl)-5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-oxadiazole (PubChem CID 1374135) has the molecular formula C19H16FN3OS and a molecular weight of 353.42 g/mol. Its IUPAC name is 2-(2,3-dimethyl-1H-indol-5-yl)-5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-(2,3-dimethyl-1H-indol-5-yl)-5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 1374135 |
| Molecular Formula | C19H16FN3OS |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 2-(2,3-dimethyl-1H-indol-5-yl)-5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-oxadiazole |
| SMILES | Cc1[nH]c2ccc(-c3nnc(SCc4ccc(F)cc4)o3)cc2c1C |
| InChI | InChI=1S/C19H16FN3OS/c1-11-12(2)21-17-8-5-14(9-16(11)17)18-22-23-19(24-18)25-10-13-3-6-15(20)7-4-13/h3-9,21H,10H2,1-2H3 |
| InChIKey | SRXFJYKGDMZVTL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|