C31H35N7O7 — CID 137415096
[5-hydroxy-4-[5-(3-morpholin-4-ylpropoxy)-1,3-dihydroisoindole-2-carbonyl]-2-propan-2-ylphenyl] 3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxylate (PubChem CID 137415096) has the molecular formula C31H35N7O7 and a molecular weight of 617.66 g/mol. Its IUPAC name is [5-hydroxy-4-[5-(3-morpholin-4-ylpropoxy)-1,3-dihydroisoindole-2-carbonyl]-2-propan-2-ylphenyl] 3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxylate.
| Compound Name | [5-hydroxy-4-[5-(3-morpholin-4-ylpropoxy)-1,3-dihydroisoindole-2-carbonyl]-2-propan-2-ylphenyl] 3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxylate |
|---|---|
| PubChem CID | 137415096 |
| Molecular Formula | C31H35N7O7 |
| Molecular Weight | 617.66 g/mol |
| Exact Mass | 617.26 |
| IUPAC Name | [5-hydroxy-4-[5-(3-morpholin-4-ylpropoxy)-1,3-dihydroisoindole-2-carbonyl]-2-propan-2-ylphenyl] 3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxylate |
| SMILES | CC(C)c1cc(C(=O)N2Cc3ccc(OCCCN4CCOCC4)cc3C2)c(O)cc1OC(=O)c1ncn2c(=O)n(C)nnc12 |
| InChI | InChI=1S/C31H35N7O7/c1-19(2)23-14-24(25(39)15-26(23)45-30(41)27-28-33-34-35(3)31(42)38(28)18-32-27)29(40)37-16-20-5-6-22(13-21(20)17-37)44-10-4-7-36-8-11-43-12-9-36/h5-6,13-15,18-19,39H,4,7-12,16-17H2,1-3H3 |
| InChIKey | KINKPQSXBLIOMV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 153.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.66 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|