C24H24INO — CID 137416089
N-(2-tert-butylphenyl)-6-ethyl-N-iododibenzofuran-4-amine (PubChem CID 137416089) has the molecular formula C24H24INO and a molecular weight of 469.37 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-6-ethyl-N-iododibenzofuran-4-amine.
| Compound Name | N-(2-tert-butylphenyl)-6-ethyl-N-iododibenzofuran-4-amine |
|---|---|
| PubChem CID | 137416089 |
| Molecular Formula | C24H24INO |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | N-(2-tert-butylphenyl)-6-ethyl-N-iododibenzofuran-4-amine |
| SMILES | CCc1cccc2c1oc1c(N(I)c3ccccc3C(C)(C)C)cccc12 |
| InChI | InChI=1S/C24H24INO/c1-5-16-10-8-11-17-18-12-9-15-21(23(18)27-22(16)17)26(25)20-14-7-6-13-19(20)24(2,3)4/h6-15H,5H2,1-4H3 |
| InChIKey | WJTJVFSOBRLVTD-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|