C26H31NOSi — CID 140873226
6-tert-butyl-N-methyl-N-(2-trimethylsilylphenyl)dibenzofuran-4-amine (PubChem CID 140873226) has the molecular formula C26H31NOSi and a molecular weight of 401.63 g/mol. Its IUPAC name is 6-tert-butyl-N-methyl-N-(2-trimethylsilylphenyl)dibenzofuran-4-amine.
| Compound Name | 6-tert-butyl-N-methyl-N-(2-trimethylsilylphenyl)dibenzofuran-4-amine |
|---|---|
| PubChem CID | 140873226 |
| Molecular Formula | C26H31NOSi |
| Molecular Weight | 401.63 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 6-tert-butyl-N-methyl-N-(2-trimethylsilylphenyl)dibenzofuran-4-amine |
| SMILES | CN(c1ccccc1[Si](C)(C)C)c1cccc2c1oc1c(C(C)(C)C)cccc12 |
| InChI | InChI=1S/C26H31NOSi/c1-26(2,3)20-14-10-12-18-19-13-11-16-22(25(19)28-24(18)20)27(4)21-15-8-9-17-23(21)29(5,6)7/h8-17H,1-7H3 |
| InChIKey | VFEAKAHGULVEFJ-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.63 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|