C21H13F6NO — CID 138651778
N-methyl-6-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]dibenzofuran-4-amine (PubChem CID 138651778) has the molecular formula C21H13F6NO and a molecular weight of 409.33 g/mol. Its IUPAC name is N-methyl-6-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]dibenzofuran-4-amine.
| Compound Name | N-methyl-6-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]dibenzofuran-4-amine |
|---|---|
| PubChem CID | 138651778 |
| Molecular Formula | C21H13F6NO |
| Molecular Weight | 409.33 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | N-methyl-6-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]dibenzofuran-4-amine |
| SMILES | CN(c1ccc(C(F)(F)F)cc1)c1cccc2c1oc1c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C21H13F6NO/c1-28(13-10-8-12(9-11-13)20(22,23)24)17-7-3-5-15-14-4-2-6-16(21(25,26)27)18(14)29-19(15)17/h2-11H,1H3 |
| InChIKey | PWBHPDDVRRVEAD-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.33 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |