C26H29NO — CID 138652817
N-(4-tert-butylphenyl)-N-methyl-6-propan-2-yldibenzofuran-4-amine (PubChem CID 138652817) has the molecular formula C26H29NO and a molecular weight of 371.52 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-N-methyl-6-propan-2-yldibenzofuran-4-amine.
| Compound Name | N-(4-tert-butylphenyl)-N-methyl-6-propan-2-yldibenzofuran-4-amine |
|---|---|
| PubChem CID | 138652817 |
| Molecular Formula | C26H29NO |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | N-(4-tert-butylphenyl)-N-methyl-6-propan-2-yldibenzofuran-4-amine |
| SMILES | CC(C)c1cccc2c1oc1c(N(C)c3ccc(C(C)(C)C)cc3)cccc12 |
| InChI | InChI=1S/C26H29NO/c1-17(2)20-9-7-10-21-22-11-8-12-23(25(22)28-24(20)21)27(6)19-15-13-18(14-16-19)26(3,4)5/h7-17H,1-6H3 |
| InChIKey | PCQPUKBTZZKAKS-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |