C55H51NO — CID 174314035
8-(4-tert-butylphenyl)-N,N-bis(9,9-dimethylfluoren-2-yl)-6-propan-2-yldibenzofuran-4-amine (PubChem CID 174314035) has the molecular formula C55H51NO and a molecular weight of 742.02 g/mol. Its IUPAC name is 8-(4-tert-butylphenyl)-N,N-bis(9,9-dimethylfluoren-2-yl)-6-propan-2-yldibenzofuran-4-amine.
| Compound Name | 8-(4-tert-butylphenyl)-N,N-bis(9,9-dimethylfluoren-2-yl)-6-propan-2-yldibenzofuran-4-amine |
|---|---|
| PubChem CID | 174314035 |
| Molecular Formula | C55H51NO |
| Molecular Weight | 742.02 g/mol |
| Exact Mass | 741.40 |
| IUPAC Name | 8-(4-tert-butylphenyl)-N,N-bis(9,9-dimethylfluoren-2-yl)-6-propan-2-yldibenzofuran-4-amine |
| SMILES | CC(C)c1cc(-c2ccc(C(C)(C)C)cc2)cc2c1oc1c(N(c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3ccc4c(c3)C(C)(C)c3ccccc3-4)cccc12 |
| InChI | InChI=1S/C55H51NO/c1-33(2)44-29-35(34-21-23-36(24-22-34)53(3,4)5)30-45-43-17-14-20-50(52(43)57-51(44)45)56(37-25-27-41-39-15-10-12-18-46(39)54(6,7)48(41)31-37)38-26-28-42-40-16-11-13-19-47(40)55(8,9)49(42)32-38/h10-33H,1-9H3 |
| InChIKey | PIHBJWCFCPKJSB-UHFFFAOYSA-N |
| XLogP | 15.76 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.02 |
| LogP ≤ 5 | 15.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |