C47H45NO — CID 176751175
6,8-ditert-butyl-N-(9,9-dimethylfluoren-2-yl)-N-(3-phenylphenyl)dibenzofuran-4-amine (PubChem CID 176751175) has the molecular formula C47H45NO and a molecular weight of 639.88 g/mol. Its IUPAC name is 6,8-ditert-butyl-N-(9,9-dimethylfluoren-2-yl)-N-(3-phenylphenyl)dibenzofuran-4-amine.
| Compound Name | 6,8-ditert-butyl-N-(9,9-dimethylfluoren-2-yl)-N-(3-phenylphenyl)dibenzofuran-4-amine |
|---|---|
| PubChem CID | 176751175 |
| Molecular Formula | C47H45NO |
| Molecular Weight | 639.88 g/mol |
| Exact Mass | 639.35 |
| IUPAC Name | 6,8-ditert-butyl-N-(9,9-dimethylfluoren-2-yl)-N-(3-phenylphenyl)dibenzofuran-4-amine |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2oc3c(N(c4cccc(-c5ccccc5)c4)c4ccc5c(c4)C(C)(C)c4ccccc4-5)cccc3c2c1 |
| InChI | InChI=1S/C47H45NO/c1-45(2,3)32-27-38-37-21-15-23-42(44(37)49-43(38)41(28-32)46(4,5)6)48(33-19-14-18-31(26-33)30-16-10-9-11-17-30)34-24-25-36-35-20-12-13-22-39(35)47(7,8)40(36)29-34/h9-29H,1-8H3 |
| InChIKey | MLSYBSHMLZYGQJ-UHFFFAOYSA-N |
| XLogP | 13.62 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.88 |
| LogP ≤ 5 | 13.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |