C47H43NOS — CID 176751229
6,8-ditert-butyl-N-dibenzothiophen-2-yl-N-(9,9-dimethylfluoren-2-yl)dibenzofuran-4-amine (PubChem CID 176751229) has the molecular formula C47H43NOS and a molecular weight of 669.93 g/mol. Its IUPAC name is 6,8-ditert-butyl-N-dibenzothiophen-2-yl-N-(9,9-dimethylfluoren-2-yl)dibenzofuran-4-amine.
| Compound Name | 6,8-ditert-butyl-N-dibenzothiophen-2-yl-N-(9,9-dimethylfluoren-2-yl)dibenzofuran-4-amine |
|---|---|
| PubChem CID | 176751229 |
| Molecular Formula | C47H43NOS |
| Molecular Weight | 669.93 g/mol |
| Exact Mass | 669.31 |
| IUPAC Name | 6,8-ditert-butyl-N-dibenzothiophen-2-yl-N-(9,9-dimethylfluoren-2-yl)dibenzofuran-4-amine |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2oc3c(N(c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4ccc5sc6ccccc6c5c4)cccc3c2c1 |
| InChI | InChI=1S/C47H43NOS/c1-45(2,3)28-24-36-34-16-13-18-40(44(34)49-43(36)39(25-28)46(4,5)6)48(29-21-23-42-35(26-29)33-15-10-12-19-41(33)50-42)30-20-22-32-31-14-9-11-17-37(31)47(7,8)38(32)27-30/h9-27H,1-8H3 |
| InChIKey | DGQZBSJVZSUYJD-UHFFFAOYSA-N |
| XLogP | 14.32 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.93 |
| LogP ≤ 5 | 14.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |