C60H62NO+ — CID 174314033
(5-tert-butyl-9,9-dimethylfluoren-2-yl)-[8-(4-tert-butylphenyl)-6-propan-2-yldibenzofuran-4-yl]-(9,9-dimethylfluoren-2-yl)-methylazanium (PubChem CID 174314033) has the molecular formula C60H62NO+ and a molecular weight of 813.16 g/mol. Its IUPAC name is (5-tert-butyl-9,9-dimethylfluoren-2-yl)-[8-(4-tert-butylphenyl)-6-propan-2-yldibenzofuran-4-yl]-(9,9-dimethylfluoren-2-yl)-methylazanium.
| Compound Name | (5-tert-butyl-9,9-dimethylfluoren-2-yl)-[8-(4-tert-butylphenyl)-6-propan-2-yldibenzofuran-4-yl]-(9,9-dimethylfluoren-2-yl)-methylazanium |
|---|---|
| PubChem CID | 174314033 |
| Molecular Formula | C60H62NO+ |
| Molecular Weight | 813.16 g/mol |
| Exact Mass | 812.48 |
| IUPAC Name | (5-tert-butyl-9,9-dimethylfluoren-2-yl)-[8-(4-tert-butylphenyl)-6-propan-2-yldibenzofuran-4-yl]-(9,9-dimethylfluoren-2-yl)-methylazanium |
| SMILES | CC(C)c1cc(-c2ccc(C(C)(C)C)cc2)cc2c1oc1c([N+](C)(c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3ccc4c(c3)C(C)(C)c3cccc(C(C)(C)C)c3-4)cccc12 |
| InChI | InChI=1S/C60H62NO/c1-36(2)46-32-38(37-24-26-39(27-25-37)57(3,4)5)33-47-44-19-16-23-53(56(44)62-55(46)47)61(13,40-28-30-43-42-18-14-15-20-48(42)59(9,10)51(43)34-40)41-29-31-45-52(35-41)60(11,12)50-22-17-21-49(54(45)50)58(6,7)8/h14-36H,1-13H3/q+1 |
| InChIKey | KIRAHEPXXKKWJQ-UHFFFAOYSA-N |
| XLogP | 17.18 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.16 |
| LogP ≤ 5 | 17.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|